C24H33N3OS — CID 57155632
3-methyl-6-[4-[2-methyl-4-(2-piperidin-1-ylethyl)pyrrol-2-yl]butyl]-1,3-benzothiazol-2-one (PubChem CID 57155632) has the molecular formula C24H33N3OS and a molecular weight of 411.62 g/mol. Its IUPAC name is 3-methyl-6-[4-[2-methyl-4-(2-piperidin-1-ylethyl)pyrrol-2-yl]butyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-methyl-6-[4-[2-methyl-4-(2-piperidin-1-ylethyl)pyrrol-2-yl]butyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 57155632 |
| Molecular Formula | C24H33N3OS |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-methyl-6-[4-[2-methyl-4-(2-piperidin-1-ylethyl)pyrrol-2-yl]butyl]-1,3-benzothiazol-2-one |
| SMILES | Cn1c(=O)sc2cc(CCCCC3(C)C=C(CCN4CCCCC4)C=N3)ccc21 |
| InChI | InChI=1S/C24H33N3OS/c1-24(17-20(18-25-24)11-15-27-13-6-3-7-14-27)12-5-4-8-19-9-10-21-22(16-19)29-23(28)26(21)2/h9-10,16-18H,3-8,11-15H2,1-2H3 |
| InChIKey | PPZZVOBHWJAWAY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|