C23H29Cl4N3OS — CID 24835441
6-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3-methyl-1,3-benzothiazol-2-one;dihydrochloride (PubChem CID 24835441) has the molecular formula C23H29Cl4N3OS and a molecular weight of 537.38 g/mol. Its IUPAC name is 6-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3-methyl-1,3-benzothiazol-2-one;dihydrochloride.
| Compound Name | 6-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3-methyl-1,3-benzothiazol-2-one;dihydrochloride |
|---|---|
| PubChem CID | 24835441 |
| Molecular Formula | C23H29Cl4N3OS |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | 6-[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]butyl]-3-methyl-1,3-benzothiazol-2-one;dihydrochloride |
| SMILES | Cl.Cl.Cn1c(=O)sc2cc(CCCCN3CCN(Cc4ccc(Cl)cc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C23H27Cl2N3OS.2ClH/c1-26-21-8-5-17(14-22(21)30-23(26)29)4-2-3-9-27-10-12-28(13-11-27)16-18-6-7-19(24)15-20(18)25;;/h5-8,14-15H,2-4,9-13,16H2,1H3;2*1H |
| InChIKey | AUHDUTLHXUIPQT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|