C36H50N2O2 — CID 57158155
2,6-dibenzyl-N',N'-bis(cyclohexylmethyl)-4-methylideneheptanediamide (PubChem CID 57158155) has the molecular formula C36H50N2O2 and a molecular weight of 542.81 g/mol. Its IUPAC name is 2,6-dibenzyl-N',N'-bis(cyclohexylmethyl)-4-methylideneheptanediamide.
| Compound Name | 2,6-dibenzyl-N',N'-bis(cyclohexylmethyl)-4-methylideneheptanediamide |
|---|---|
| PubChem CID | 57158155 |
| Molecular Formula | C36H50N2O2 |
| Molecular Weight | 542.81 g/mol |
| Exact Mass | 542.39 |
| IUPAC Name | 2,6-dibenzyl-N',N'-bis(cyclohexylmethyl)-4-methylideneheptanediamide |
| SMILES | C=C(CC(Cc1ccccc1)C(N)=O)CC(Cc1ccccc1)C(=O)N(CC1CCCCC1)CC1CCCCC1 |
| InChI | InChI=1S/C36H50N2O2/c1-28(22-33(35(37)39)24-29-14-6-2-7-15-29)23-34(25-30-16-8-3-9-17-30)36(40)38(26-31-18-10-4-11-19-31)27-32-20-12-5-13-21-32/h2-3,6-9,14-17,31-34H,1,4-5,10-13,18-27H2,(H2,37,39) |
| InChIKey | CUCVCXXFYHERLK-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.81 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|