C17H24NNaO6S — CID 58369233
sodium 2-[cyclohexylmethyl(phenylmethoxycarbonyl)amino]-1-hydroxyethanesulfonate (PubChem CID 58369233) has the molecular formula C17H24NNaO6S and a molecular weight of 393.44 g/mol. Its IUPAC name is sodium 2-[cyclohexylmethyl(phenylmethoxycarbonyl)amino]-1-hydroxyethanesulfonate.
| Compound Name | sodium 2-[cyclohexylmethyl(phenylmethoxycarbonyl)amino]-1-hydroxyethanesulfonate |
|---|---|
| PubChem CID | 58369233 |
| Molecular Formula | C17H24NNaO6S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | sodium 2-[cyclohexylmethyl(phenylmethoxycarbonyl)amino]-1-hydroxyethanesulfonate |
| SMILES | O=C(OCc1ccccc1)N(CC1CCCCC1)CC(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H25NO6S.Na/c19-16(25(21,22)23)12-18(11-14-7-3-1-4-8-14)17(20)24-13-15-9-5-2-6-10-15;/h2,5-6,9-10,14,16,19H,1,3-4,7-8,11-13H2,(H,21,22,23);/q;+1/p-1 |
| InChIKey | OJVGIZRFDVXGKD-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|