C17H33NO — CID 57159425
1-[4-(tert-butylamino)cycloheptyl]-3,3-dimethylbutan-1-one (PubChem CID 57159425) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is 1-[4-(tert-butylamino)cycloheptyl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(tert-butylamino)cycloheptyl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 57159425 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | 1-[4-(tert-butylamino)cycloheptyl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)C1CCCC(NC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33NO/c1-16(2,3)12-15(19)13-8-7-9-14(11-10-13)18-17(4,5)6/h13-14,18H,7-12H2,1-6H3 |
| InChIKey | QRLXLIMDCQEPOW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |