C20H38S2 — CID 57159900
3-heptyl-4-(oct-2-enylsulfanylmethyl)thiolane (PubChem CID 57159900) has the molecular formula C20H38S2 and a molecular weight of 342.66 g/mol. Its IUPAC name is 3-heptyl-4-(oct-2-enylsulfanylmethyl)thiolane.
| Compound Name | 3-heptyl-4-(oct-2-enylsulfanylmethyl)thiolane |
|---|---|
| PubChem CID | 57159900 |
| Molecular Formula | C20H38S2 |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 3-heptyl-4-(oct-2-enylsulfanylmethyl)thiolane |
| SMILES | CCCCCC=CCSCC1CSCC1CCCCCCC |
| InChI | InChI=1S/C20H38S2/c1-3-5-7-9-11-13-15-21-17-20-18-22-16-19(20)14-12-10-8-6-4-2/h11,13,19-20H,3-10,12,14-18H2,1-2H3 |
| InChIKey | HRTXHELRONKPME-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|