C19H27N3O4 — CID 57160079
tert-butyl 4-[[(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoyl]amino]butanoate (PubChem CID 57160079) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoyl]amino]butanoate.
| Compound Name | tert-butyl 4-[[(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 57160079 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl 4-[[(2S)-2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=O)[C@@H](N)Cc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C19H27N3O4/c1-19(2,3)26-17(24)5-4-8-21-18(25)15(20)9-12-11-22-16-7-6-13(23)10-14(12)16/h6-7,10-11,15,22-23H,4-5,8-9,20H2,1-3H3,(H,21,25)/t15-/m0/s1 |
| InChIKey | IPJGJCHQYAZQIG-HNNXBMFYSA-N |
| XLogP | 1.98 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|