About 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile
4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile (PubChem CID 57162482) has the molecular formula C14H15N3O
and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile |
| PubChem CID | 57162482 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2=CC3(CCNCC3)ON2)cc1 |
| InChI | InChI=1S/C14H15N3O/c15-10-11-1-3-12(4-2-11)13-9-14(18-17-13)5-7-16-8-6-14/h1-4,9,16-17H,5-8H2 |
| InChIKey | CZQFEBJDLUWLOM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile?
The IUPAC name of 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile (CID 57162482) is 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile.
What is the SMILES notation for 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile?
The canonical SMILES for 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile is N#Cc1ccc(C2=CC3(CCNCC3)ON2)cc1.
What is the InChIKey of 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile?
The InChIKey is CZQFEBJDLUWLOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O/c15-10-11-1-3-12(4-2-11)13-9-14(18-17-13)5-7-16-8-6-14/h1-4,9,16-17H,5-8H2.
What are the key properties of 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile?
4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile has a molecular weight of 241.29 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-oxa-2,8-diazaspiro[4.5]dec-3-en-3-yl)benzonitrile is sourced from PubChem (CID 57162482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).