C12H14N2O — CID 90811093
3-phenyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene (PubChem CID 90811093) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-phenyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene.
| Compound Name | 3-phenyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 90811093 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-phenyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene |
| SMILES | C1=C(c2ccccc2)NOC12CCNC2 |
| InChI | InChI=1S/C12H14N2O/c1-2-4-10(5-3-1)11-8-12(15-14-11)6-7-13-9-12/h1-5,8,13-14H,6-7,9H2 |
| InChIKey | WOAVIWJSOVWYHI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |