C14H18N2O — CID 91077605
3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene (PubChem CID 91077605) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene.
| Compound Name | 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene |
|---|---|
| PubChem CID | 91077605 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene |
| SMILES | C1=C(c2ccccc2)NOC12CCCNCC2 |
| InChI | InChI=1S/C14H18N2O/c1-2-5-12(6-3-1)13-11-14(17-16-13)7-4-9-15-10-8-14/h1-3,5-6,11,15-16H,4,7-10H2 |
| InChIKey | HUFSLUVMGKUPQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |