C14H18N2O — CID 91614864
6-methyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 91614864) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-methyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 6-methyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 91614864 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 6-methyl-3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | CC1CNCCC12C=C(c1ccccc1)NO2 |
| InChI | InChI=1S/C14H18N2O/c1-11-10-15-8-7-14(11)9-13(16-17-14)12-5-3-2-4-6-12/h2-6,9,11,15-16H,7-8,10H2,1H3 |
| InChIKey | NRLYBWUKXVJJLL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |