C20H27N3O3 — CID 90829383
(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-cyclohexylcarbamate (PubChem CID 90829383) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-cyclohexylcarbamate.
| Compound Name | (3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 90829383 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl) N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)ON1CCC2(C=C(c3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C20H27N3O3/c24-19(21-17-9-5-2-6-10-17)25-23-13-11-20(12-14-23)15-18(22-26-20)16-7-3-1-4-8-16/h1,3-4,7-8,15,17,22H,2,5-6,9-14H2,(H,21,24) |
| InChIKey | YRXBYTJYOQLNTR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |