C25H35N3O2V — CID 59036852
1-benzyl-N-phenylpiperidin-4-amine;tert-butyl N-ethylcarbamate;vanadium(2+) (PubChem CID 59036852) has the molecular formula C25H35N3O2V and a molecular weight of 460.52 g/mol. Its IUPAC name is 1-benzyl-N-phenylpiperidin-4-amine;tert-butyl N-ethylcarbamate;vanadium(2+).
| Compound Name | 1-benzyl-N-phenylpiperidin-4-amine;tert-butyl N-ethylcarbamate;vanadium(2+) |
|---|---|
| PubChem CID | 59036852 |
| Molecular Formula | C25H35N3O2V |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1-benzyl-N-phenylpiperidin-4-amine;tert-butyl N-ethylcarbamate;vanadium(2+) |
| SMILES | [CH2-]CNC(=O)OC(C)(C)C.[V+2].[c-]1ccc(NC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C18H21N2.C7H14NO2.V/c1-3-7-16(8-4-1)15-20-13-11-18(12-14-20)19-17-9-5-2-6-10-17;1-5-8-6(9)10-7(2,3)4;/h1,3-10,18-19H,11-15H2;1,5H2,2-4H3,(H,8,9);/q2*-1;+2 |
| InChIKey | UZTYTZUJVPVGJA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|