C17H22N2O3 — CID 68884210
(2-cyclohexyl-5-methyl-3-phenyl-5H-1,2-oxazol-4-yl)carbamic acid (PubChem CID 68884210) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2-cyclohexyl-5-methyl-3-phenyl-5H-1,2-oxazol-4-yl)carbamic acid.
| Compound Name | (2-cyclohexyl-5-methyl-3-phenyl-5H-1,2-oxazol-4-yl)carbamic acid |
|---|---|
| PubChem CID | 68884210 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2-cyclohexyl-5-methyl-3-phenyl-5H-1,2-oxazol-4-yl)carbamic acid |
| SMILES | CC1ON(C2CCCCC2)C(c2ccccc2)=C1NC(=O)O |
| InChI | InChI=1S/C17H22N2O3/c1-12-15(18-17(20)21)16(13-8-4-2-5-9-13)19(22-12)14-10-6-3-7-11-14/h2,4-5,8-9,12,14,18H,3,6-7,10-11H2,1H3,(H,20,21) |
| InChIKey | KMSDIWCVYAXCAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |