C13H15ClN2O — CID 90822069
3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 90822069) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 90822069 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | Clc1ccc(C2=CC3(CCNCC3)ON2)cc1 |
| InChI | InChI=1S/C13H15ClN2O/c14-11-3-1-10(2-4-11)12-9-13(17-16-12)5-7-15-8-6-13/h1-4,9,15-16H,5-8H2 |
| InChIKey | MYEXCXHUHDSRGJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |