C22H30ClN3OS — CID 91021578
3-(4-chlorophenyl)-N-cyclooctyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91021578) has the molecular formula C22H30ClN3OS and a molecular weight of 420.02 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-cyclooctyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | 3-(4-chlorophenyl)-N-cyclooctyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91021578 |
| Molecular Formula | C22H30ClN3OS |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-(4-chlorophenyl)-N-cyclooctyl-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | S=C(NC1CCCCCCC1)N1CCC2(C=C(c3ccc(Cl)cc3)NO2)CC1 |
| InChI | InChI=1S/C22H30ClN3OS/c23-18-10-8-17(9-11-18)20-16-22(27-25-20)12-14-26(15-13-22)21(28)24-19-6-4-2-1-3-5-7-19/h8-11,16,19,25H,1-7,12-15H2,(H,24,28) |
| InChIKey | KNMHJTILUJDNBF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|