C21H28ClN3OS — CID 91042543
3-(4-chlorophenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide (PubChem CID 91042543) has the molecular formula C21H28ClN3OS and a molecular weight of 406.00 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide.
| Compound Name | 3-(4-chlorophenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
|---|---|
| PubChem CID | 91042543 |
| Molecular Formula | C21H28ClN3OS |
| Molecular Weight | 406.00 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(cyclohexylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-ene-8-carbothioamide |
| SMILES | S=C(NCC1CCCCC1)N1CCC2(C=C(c3ccc(Cl)cc3)NO2)CC1 |
| InChI | InChI=1S/C21H28ClN3OS/c22-18-8-6-17(7-9-18)19-14-21(26-24-19)10-12-25(13-11-21)20(27)23-15-16-4-2-1-3-5-16/h6-9,14,16,24H,1-5,10-13,15H2,(H,23,27) |
| InChIKey | OTPMUJGMVDRPGX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|