C21H29N3O2S — CID 90952247
O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-(cyclohexylmethyl)carbamothioate (PubChem CID 90952247) has the molecular formula C21H29N3O2S and a molecular weight of 387.55 g/mol. Its IUPAC name is O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-(cyclohexylmethyl)carbamothioate.
| Compound Name | O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-(cyclohexylmethyl)carbamothioate |
|---|---|
| PubChem CID | 90952247 |
| Molecular Formula | C21H29N3O2S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | O-[(3-phenyl-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl)] N-(cyclohexylmethyl)carbamothioate |
| SMILES | S=C(NCC1CCCCC1)ON1CCC2(C=C(c3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C21H29N3O2S/c27-20(22-16-17-7-3-1-4-8-17)25-24-13-11-21(12-14-24)15-19(23-26-21)18-9-5-2-6-10-18/h2,5-6,9-10,15,17,23H,1,3-4,7-8,11-14,16H2,(H,22,27) |
| InChIKey | YUWIJMUJKVUNPP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|