C16H24N2O — CID 167163831
N-butyl-3-(1-phenylethylamino)oxybuta-1,3-dien-2-amine (PubChem CID 167163831) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-butyl-3-(1-phenylethylamino)oxybuta-1,3-dien-2-amine.
| Compound Name | N-butyl-3-(1-phenylethylamino)oxybuta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 167163831 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-butyl-3-(1-phenylethylamino)oxybuta-1,3-dien-2-amine |
| SMILES | C=C(NCCCC)C(=C)ONC(C)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-5-6-12-17-13(2)15(4)19-18-14(3)16-10-8-7-9-11-16/h7-11,14,17-18H,2,4-6,12H2,1,3H3 |
| InChIKey | WNHJTZHRZDUPBB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|