C14H13FN2O — CID 123496392
3-[2-(3-fluorophenyl)ethynyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene (PubChem CID 123496392) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)ethynyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene.
| Compound Name | 3-[2-(3-fluorophenyl)ethynyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 123496392 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-[2-(3-fluorophenyl)ethynyl]-1-oxa-2,7-diazaspiro[4.4]non-3-ene |
| SMILES | Fc1cccc(C#CC2=CC3(CCNC3)ON2)c1 |
| InChI | InChI=1S/C14H13FN2O/c15-12-3-1-2-11(8-12)4-5-13-9-14(18-17-13)6-7-16-10-14/h1-3,8-9,16-17H,6-7,10H2 |
| InChIKey | PAEUJZSGBOOTCZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|