C15H17NO4S — CID 57164476
6-(1-hydroxyethyl)-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57164476) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | 6-(1-hydroxyethyl)-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57164476 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 6-(1-hydroxyethyl)-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(O)C1C(=O)N2C1CC(Sc1ccccc1)C2C(=O)O |
| InChI | InChI=1S/C15H17NO4S/c1-8(17)12-10-7-11(21-9-5-3-2-4-6-9)13(15(19)20)16(10)14(12)18/h2-6,8,10-13,17H,7H2,1H3,(H,19,20) |
| InChIKey | AMLYRQLRCPZBTI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |