C13H17NO2S2 — CID 57164748
4-amino-4-(1-benzothiophen-2-yl)-2-methylbutane-1-sulfinic acid (PubChem CID 57164748) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-amino-4-(1-benzothiophen-2-yl)-2-methylbutane-1-sulfinic acid.
| Compound Name | 4-amino-4-(1-benzothiophen-2-yl)-2-methylbutane-1-sulfinic acid |
|---|---|
| PubChem CID | 57164748 |
| Molecular Formula | C13H17NO2S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-amino-4-(1-benzothiophen-2-yl)-2-methylbutane-1-sulfinic acid |
| SMILES | CC(CC(N)c1cc2ccccc2s1)CS(=O)O |
| InChI | InChI=1S/C13H17NO2S2/c1-9(8-18(15)16)6-11(14)13-7-10-4-2-3-5-12(10)17-13/h2-5,7,9,11H,6,8,14H2,1H3,(H,15,16) |
| InChIKey | UVIYMGMBPUETCH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|