C23H36O2 — CID 57166732
2-[(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-yl]acetic acid (PubChem CID 57166732) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-yl]acetic acid.
| Compound Name | 2-[(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-yl]acetic acid |
|---|---|
| PubChem CID | 57166732 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-[(8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-3-yl]acetic acid |
| SMILES | CC[C@H]1CC[C@H]2[C@@H]3CCC4CC(CC(=O)O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H36O2/c1-4-16-6-8-19-18-7-5-17-13-15(14-21(24)25)9-11-23(17,3)20(18)10-12-22(16,19)2/h9,11,15-20H,4-8,10,12-14H2,1-3H3,(H,24,25)/t15?,16-,17?,18-,19-,20-,22+,23-/m0/s1 |
| InChIKey | UHWNJTWJHRFWGL-VWZYFDQDSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|