C12H20O3 — CID 57168205
5-hydroxy-5-prop-1-enylnonane-2,8-dione (PubChem CID 57168205) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-hydroxy-5-prop-1-enylnonane-2,8-dione.
| Compound Name | 5-hydroxy-5-prop-1-enylnonane-2,8-dione |
|---|---|
| PubChem CID | 57168205 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 5-hydroxy-5-prop-1-enylnonane-2,8-dione |
| SMILES | CC=CC(O)(CCC(C)=O)CCC(C)=O |
| InChI | InChI=1S/C12H20O3/c1-4-7-12(15,8-5-10(2)13)9-6-11(3)14/h4,7,15H,5-6,8-9H2,1-3H3 |
| InChIKey | FMEHQILWUHPEJD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|