C22H28F3NO3S — CID 57168604
O-propyl (2R)-1-(3,3-dimethyl-2-oxopentanoyl)-2-phenyl-4-(trifluoromethyl)pyrrolidine-2-carbothioate (PubChem CID 57168604) has the molecular formula C22H28F3NO3S and a molecular weight of 443.53 g/mol. Its IUPAC name is O-propyl (2R)-1-(3,3-dimethyl-2-oxopentanoyl)-2-phenyl-4-(trifluoromethyl)pyrrolidine-2-carbothioate.
| Compound Name | O-propyl (2R)-1-(3,3-dimethyl-2-oxopentanoyl)-2-phenyl-4-(trifluoromethyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 57168604 |
| Molecular Formula | C22H28F3NO3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | O-propyl (2R)-1-(3,3-dimethyl-2-oxopentanoyl)-2-phenyl-4-(trifluoromethyl)pyrrolidine-2-carbothioate |
| SMILES | CCCOC(=S)[C@]1(c2ccccc2)CC(C(F)(F)F)CN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C22H28F3NO3S/c1-5-12-29-19(30)21(15-10-8-7-9-11-15)13-16(22(23,24)25)14-26(21)18(28)17(27)20(3,4)6-2/h7-11,16H,5-6,12-14H2,1-4H3/t16?,21-/m1/s1 |
| InChIKey | WJQPRQCUHBMHDS-CAWMZFRYSA-N |
| XLogP | 5.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|