About [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate
[2-(4-methoxyphenoxy)acetyl] hex-4-ynoate (PubChem CID 57169540) has the molecular formula C15H16O5
and a molecular weight of 276.29 g/mol. Its IUPAC name is [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate.
Molecular Properties
| Compound Name | [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate |
| PubChem CID | 57169540 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate |
| SMILES | CC#CCCC(=O)OC(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H16O5/c1-3-4-5-6-14(16)20-15(17)11-19-13-9-7-12(18-2)8-10-13/h7-10H,5-6,11H2,1-2H3 |
| InChIKey | JQMUGOXCLOSDAG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate?
The IUPAC name of [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate (CID 57169540) is [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate.
What is the SMILES notation for [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate?
The canonical SMILES for [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate is CC#CCCC(=O)OC(=O)COc1ccc(OC)cc1.
What is the InChIKey of [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate?
The InChIKey is JQMUGOXCLOSDAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O5/c1-3-4-5-6-14(16)20-15(17)11-19-13-9-7-12(18-2)8-10-13/h7-10H,5-6,11H2,1-2H3.
What are the key properties of [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate?
[2-(4-methoxyphenoxy)acetyl] hex-4-ynoate has a molecular weight of 276.29 g/mol, XLogP of 1.95, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methoxyphenoxy)acetyl] hex-4-ynoate is sourced from PubChem (CID 57169540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).