C16H19NO4 — CID 57170741
1-(1,3-benzodioxol-2-yl)-5-morpholin-4-ylpent-1-en-3-one (PubChem CID 57170741) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-2-yl)-5-morpholin-4-ylpent-1-en-3-one.
| Compound Name | 1-(1,3-benzodioxol-2-yl)-5-morpholin-4-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 57170741 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(1,3-benzodioxol-2-yl)-5-morpholin-4-ylpent-1-en-3-one |
| SMILES | O=C(C=CC1Oc2ccccc2O1)CCN1CCOCC1 |
| InChI | InChI=1S/C16H19NO4/c18-13(7-8-17-9-11-19-12-10-17)5-6-16-20-14-3-1-2-4-15(14)21-16/h1-6,16H,7-12H2 |
| InChIKey | RGRHNMKGCMJXLF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|