C15H18Cl3NO2 — CID 70518223
1-(2,6-dichlorophenyl)-5-morpholin-4-ylpent-1-en-3-one;hydrochloride (PubChem CID 70518223) has the molecular formula C15H18Cl3NO2 and a molecular weight of 350.67 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-morpholin-4-ylpent-1-en-3-one;hydrochloride.
| Compound Name | 1-(2,6-dichlorophenyl)-5-morpholin-4-ylpent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 70518223 |
| Molecular Formula | C15H18Cl3NO2 |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-morpholin-4-ylpent-1-en-3-one;hydrochloride |
| SMILES | Cl.O=C(C=Cc1c(Cl)cccc1Cl)CCN1CCOCC1 |
| InChI | InChI=1S/C15H17Cl2NO2.ClH/c16-14-2-1-3-15(17)13(14)5-4-12(19)6-7-18-8-10-20-11-9-18;/h1-5H,6-11H2;1H |
| InChIKey | WOQNIXVJNYRJRX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|