About 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid
3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid (PubChem CID 57171190) has the molecular formula C10H10N2O4
and a molecular weight of 222.20 g/mol. Its IUPAC name is 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid.
Molecular Properties
| Compound Name | 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid |
| PubChem CID | 57171190 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid |
| SMILES | N[C@@H]1C(=O)N[C@@H]1Oc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C10H10N2O4/c11-7-8(13)12-9(7)16-6-3-1-2-5(4-6)10(14)15/h1-4,7,9H,11H2,(H,12,13)(H,14,15)/t7-,9-/m1/s1 |
| InChIKey | PRYDSWXEGYHOPC-VXNVDRBHSA-N |
| XLogP | -0.45 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid?
The IUPAC name of 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid (CID 57171190) is 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid.
What is the SMILES notation for 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid?
The canonical SMILES for 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid is N[C@@H]1C(=O)N[C@@H]1Oc1cccc(C(=O)O)c1.
What is the InChIKey of 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid?
The InChIKey is PRYDSWXEGYHOPC-VXNVDRBHSA-N. The full InChI is InChI=1S/C10H10N2O4/c11-7-8(13)12-9(7)16-6-3-1-2-5(4-6)10(14)15/h1-4,7,9H,11H2,(H,12,13)(H,14,15)/t7-,9-/m1/s1.
What are the key properties of 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid?
3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid has a molecular weight of 222.20 g/mol, XLogP of -0.45, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,3S)-3-amino-4-oxoazetidin-2-yl]oxybenzoic acid is sourced from PubChem (CID 57171190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).