C14H19N3O — CID 57172010
butyl-[(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)methyl]diazene (PubChem CID 57172010) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is butyl-[(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)methyl]diazene.
| Compound Name | butyl-[(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)methyl]diazene |
|---|---|
| PubChem CID | 57172010 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | butyl-[(3-phenyl-2,5-dihydro-1,2-oxazol-4-yl)methyl]diazene |
| SMILES | CCCC/N=N/CC1=C(c2ccccc2)NOC1 |
| InChI | InChI=1S/C14H19N3O/c1-2-3-9-15-16-10-13-11-18-17-14(13)12-7-5-4-6-8-12/h4-8,17H,2-3,9-11H2,1H3/b16-15+ |
| InChIKey | GEXGJSZKPJNAJF-FOCLMDBBSA-N |
| XLogP | 3.18 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|