C22H22ClNO3 — CID 57172090
(1R)-1-(3-chlorophenyl)-3-[(4-pyridin-2-yloxyphenyl)methyl]butane-1,4-diol (PubChem CID 57172090) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-3-[(4-pyridin-2-yloxyphenyl)methyl]butane-1,4-diol.
| Compound Name | (1R)-1-(3-chlorophenyl)-3-[(4-pyridin-2-yloxyphenyl)methyl]butane-1,4-diol |
|---|---|
| PubChem CID | 57172090 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-3-[(4-pyridin-2-yloxyphenyl)methyl]butane-1,4-diol |
| SMILES | OCC(Cc1ccc(Oc2ccccn2)cc1)C[C@@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClNO3/c23-19-5-3-4-18(14-19)21(26)13-17(15-25)12-16-7-9-20(10-8-16)27-22-6-1-2-11-24-22/h1-11,14,17,21,25-26H,12-13,15H2/t17?,21-/m1/s1 |
| InChIKey | JSDPSAJPUIBTBG-FBLFFUNLSA-N |
| XLogP | 4.80 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |