C10H18Br4O3 — CID 57172833
3,3-dibromo-3-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-ol (PubChem CID 57172833) has the molecular formula C10H18Br4O3 and a molecular weight of 505.87 g/mol. Its IUPAC name is 3,3-dibromo-3-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-ol.
| Compound Name | 3,3-dibromo-3-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 57172833 |
| Molecular Formula | C10H18Br4O3 |
| Molecular Weight | 505.87 g/mol |
| Exact Mass | 501.80 |
| IUPAC Name | 3,3-dibromo-3-(1,1-dibromo-3-hydroxy-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)C(Br)(Br)OC(Br)(Br)C(C)(C)CO |
| InChI | InChI=1S/C10H18Br4O3/c1-7(2,5-15)9(11,12)17-10(13,14)8(3,4)6-16/h15-16H,5-6H2,1-4H3 |
| InChIKey | VWVBOUCESJBZBG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|