C23H47P — CID 57175302
1,5,9-tri(butan-2-yl)-phosphacyclododecane (PubChem CID 57175302) has the molecular formula C23H47P and a molecular weight of 354.60 g/mol. Its IUPAC name is 1,5,9-tri(butan-2-yl)-phosphacyclododecane.
| Compound Name | 1,5,9-tri(butan-2-yl)-phosphacyclododecane |
|---|---|
| PubChem CID | 57175302 |
| Molecular Formula | C23H47P |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.34 |
| IUPAC Name | 1,5,9-tri(butan-2-yl)-phosphacyclododecane |
| SMILES | CCC(C)C1CCCC(C(C)CC)CCCP(C(C)CC)CCC1 |
| InChI | InChI=1S/C23H47P/c1-7-19(4)22-13-10-14-23(20(5)8-2)16-12-18-24(17-11-15-22)21(6)9-3/h19-23H,7-18H2,1-6H3 |
| InChIKey | UYRRTQMFNBVCBE-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|