C22H25N3O5 — CID 57179352
3-methylbutylcarbamoyl N-[2-hydroxy-2-(5-phenyl-1,3-benzoxazol-2-yl)ethyl]carbamate (PubChem CID 57179352) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-methylbutylcarbamoyl N-[2-hydroxy-2-(5-phenyl-1,3-benzoxazol-2-yl)ethyl]carbamate.
| Compound Name | 3-methylbutylcarbamoyl N-[2-hydroxy-2-(5-phenyl-1,3-benzoxazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 57179352 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-methylbutylcarbamoyl N-[2-hydroxy-2-(5-phenyl-1,3-benzoxazol-2-yl)ethyl]carbamate |
| SMILES | CC(C)CCNC(=O)OC(=O)NCC(O)c1nc2cc(-c3ccccc3)ccc2o1 |
| InChI | InChI=1S/C22H25N3O5/c1-14(2)10-11-23-21(27)30-22(28)24-13-18(26)20-25-17-12-16(8-9-19(17)29-20)15-6-4-3-5-7-15/h3-9,12,14,18,26H,10-11,13H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | IUGNUAVJINACIU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|