C21H22 — CID 57180728
1-(2-ethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)naphthalene (PubChem CID 57180728) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(2-ethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)naphthalene.
| Compound Name | 1-(2-ethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)naphthalene |
|---|---|
| PubChem CID | 57180728 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(2-ethyl-4,5,6,7-tetrahydro-2H-inden-4-yl)naphthalene |
| SMILES | CCC1C=C2CCCC(c3cccc4ccccc34)C2=C1 |
| InChI | InChI=1S/C21H22/c1-2-15-13-17-9-6-12-20(21(17)14-15)19-11-5-8-16-7-3-4-10-18(16)19/h3-5,7-8,10-11,13-15,20H,2,6,9,12H2,1H3 |
| InChIKey | AXFYAGVMPLDCFT-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |