About 1-hexyl-2-benzofuran
1-hexyl-2-benzofuran (PubChem CID 57181539) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-hexyl-2-benzofuran.
Molecular Properties
| Compound Name | 1-hexyl-2-benzofuran |
| PubChem CID | 57181539 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-hexyl-2-benzofuran |
| SMILES | CCCCCCc1occ2ccccc12 |
| InChI | InChI=1S/C14H18O/c1-2-3-4-5-10-14-13-9-7-6-8-12(13)11-15-14/h6-9,11H,2-5,10H2,1H3 |
| InChIKey | ISMZIBIVWMZLFP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-2-benzofuran?
The IUPAC name of 1-hexyl-2-benzofuran (CID 57181539) is 1-hexyl-2-benzofuran.
What is the SMILES notation for 1-hexyl-2-benzofuran?
The canonical SMILES for 1-hexyl-2-benzofuran is CCCCCCc1occ2ccccc12.
What is the InChIKey of 1-hexyl-2-benzofuran?
The InChIKey is ISMZIBIVWMZLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-2-3-4-5-10-14-13-9-7-6-8-12(13)11-15-14/h6-9,11H,2-5,10H2,1H3.
What are the key properties of 1-hexyl-2-benzofuran?
1-hexyl-2-benzofuran has a molecular weight of 202.30 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-2-benzofuran is sourced from PubChem (CID 57181539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).