C9H9N3O — CID 57181715
3-methoxy-3-phenyl-1,2,4-triazole (PubChem CID 57181715) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-methoxy-3-phenyl-1,2,4-triazole.
| Compound Name | 3-methoxy-3-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 57181715 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 3-methoxy-3-phenyl-1,2,4-triazole |
| SMILES | COC1(c2ccccc2)N=CN=N1 |
| InChI | InChI=1S/C9H9N3O/c1-13-9(10-7-11-12-9)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | WMDHYJWDDYFMIN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |