C31H40N3O3PS — CID 57182064
[[2-cyano-2-(3-tritylsulfanylpropoxy)ethyl]-[di(propan-2-yl)amino]amino]phosphonous acid (PubChem CID 57182064) has the molecular formula C31H40N3O3PS and a molecular weight of 565.72 g/mol. Its IUPAC name is [[2-cyano-2-(3-tritylsulfanylpropoxy)ethyl]-[di(propan-2-yl)amino]amino]phosphonous acid.
| Compound Name | [[2-cyano-2-(3-tritylsulfanylpropoxy)ethyl]-[di(propan-2-yl)amino]amino]phosphonous acid |
|---|---|
| PubChem CID | 57182064 |
| Molecular Formula | C31H40N3O3PS |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | [[2-cyano-2-(3-tritylsulfanylpropoxy)ethyl]-[di(propan-2-yl)amino]amino]phosphonous acid |
| SMILES | CC(C)N(C(C)C)N(CC(C#N)OCCCSC(c1ccccc1)(c1ccccc1)c1ccccc1)P(O)O |
| InChI | InChI=1S/C31H40N3O3PS/c1-25(2)34(26(3)4)33(38(35)36)24-30(23-32)37-21-14-22-39-31(27-15-8-5-9-16-27,28-17-10-6-11-18-28)29-19-12-7-13-20-29/h5-13,15-20,25-26,30,35-36H,14,21-22,24H2,1-4H3 |
| InChIKey | BSNJQWNIFZCHMO-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|