C13H15N3O2 — CID 57184043
azepan-2-yl(2,1,3-benzoxadiazol-5-yl)methanone (PubChem CID 57184043) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is azepan-2-yl(2,1,3-benzoxadiazol-5-yl)methanone.
| Compound Name | azepan-2-yl(2,1,3-benzoxadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 57184043 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | azepan-2-yl(2,1,3-benzoxadiazol-5-yl)methanone |
| SMILES | O=C(c1ccc2nonc2c1)C1CCCCCN1 |
| InChI | InChI=1S/C13H15N3O2/c17-13(11-4-2-1-3-7-14-11)9-5-6-10-12(8-9)16-18-15-10/h5-6,8,11,14H,1-4,7H2 |
| InChIKey | PBRNDHWKPATBSO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |