C17H19NO3 — CID 57184881
methyl (2S)-1-[2-(1H-inden-1-yl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 57184881) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (2S)-1-[2-(1H-inden-1-yl)acetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[2-(1H-inden-1-yl)acetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57184881 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl (2S)-1-[2-(1H-inden-1-yl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)CC1C=Cc2ccccc21 |
| InChI | InChI=1S/C17H19NO3/c1-21-17(20)15-7-4-10-18(15)16(19)11-13-9-8-12-5-2-3-6-14(12)13/h2-3,5-6,8-9,13,15H,4,7,10-11H2,1H3/t13?,15-/m0/s1 |
| InChIKey | CGUSCAGAODXPFZ-WUJWULDRSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |