C19H29ClN2O — CID 57187564
1-(4-chlorophenyl)-N-[3-(dimethylamino)propoxy]-6-methylhepta-1,3-dien-3-amine (PubChem CID 57187564) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-(dimethylamino)propoxy]-6-methylhepta-1,3-dien-3-amine.
| Compound Name | 1-(4-chlorophenyl)-N-[3-(dimethylamino)propoxy]-6-methylhepta-1,3-dien-3-amine |
|---|---|
| PubChem CID | 57187564 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-(dimethylamino)propoxy]-6-methylhepta-1,3-dien-3-amine |
| SMILES | CC(C)CC=C(C=Cc1ccc(Cl)cc1)NOCCCN(C)C |
| InChI | InChI=1S/C19H29ClN2O/c1-16(2)6-12-19(21-23-15-5-14-22(3)4)13-9-17-7-10-18(20)11-8-17/h7-13,16,21H,5-6,14-15H2,1-4H3 |
| InChIKey | AIDOGDNYXXCRJL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|