C19H18F3N3O3 — CID 57188667
2-methoxyimino-2-[2-[[1-[4-(trifluoromethyl)phenyl]ethenylamino]oxymethyl]phenyl]acetamide (PubChem CID 57188667) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 2-methoxyimino-2-[2-[[1-[4-(trifluoromethyl)phenyl]ethenylamino]oxymethyl]phenyl]acetamide.
| Compound Name | 2-methoxyimino-2-[2-[[1-[4-(trifluoromethyl)phenyl]ethenylamino]oxymethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 57188667 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-methoxyimino-2-[2-[[1-[4-(trifluoromethyl)phenyl]ethenylamino]oxymethyl]phenyl]acetamide |
| SMILES | C=C(NOCc1ccccc1C(=NOC)C(N)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3O3/c1-12(13-7-9-15(10-8-13)19(20,21)22)24-28-11-14-5-3-4-6-16(14)17(18(23)26)25-27-2/h3-10,24H,1,11H2,2H3,(H2,23,26) |
| InChIKey | BRPIXZDBIHATBA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|