About 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole
2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 57191720) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole |
| PubChem CID | 57191720 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc2c(c1)nnn2C1=NCCO1 |
| InChI | InChI=1S/C9H8N4O/c1-2-4-8-7(3-1)11-12-13(8)9-10-5-6-14-9/h1-4H,5-6H2 |
| InChIKey | GZYUZFZVIVCHDV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole (CID 57191720) is 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole is c1ccc2c(c1)nnn2C1=NCCO1.
What is the InChIKey of 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole?
The InChIKey is GZYUZFZVIVCHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c1-2-4-8-7(3-1)11-12-13(8)9-10-5-6-14-9/h1-4H,5-6H2.
What are the key properties of 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole?
2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole has a molecular weight of 188.19 g/mol, XLogP of 0.67, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-1-yl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 57191720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).