C13H17NO3 — CID 57193275
4-(3,3-dimethyl-4-oxobutoxy)benzamide (PubChem CID 57193275) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-(3,3-dimethyl-4-oxobutoxy)benzamide.
| Compound Name | 4-(3,3-dimethyl-4-oxobutoxy)benzamide |
|---|---|
| PubChem CID | 57193275 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 4-(3,3-dimethyl-4-oxobutoxy)benzamide |
| SMILES | CC(C)(C=O)CCOc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-13(2,9-15)7-8-17-11-5-3-10(4-6-11)12(14)16/h3-6,9H,7-8H2,1-2H3,(H2,14,16) |
| InChIKey | BFBFVANTIFSUNU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|