C11H11N3O3 — CID 57193748
[3-(2,4-dioxopyrrolidin-3-yl)phenyl]urea (PubChem CID 57193748) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is [3-(2,4-dioxopyrrolidin-3-yl)phenyl]urea.
| Compound Name | [3-(2,4-dioxopyrrolidin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 57193748 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | [3-(2,4-dioxopyrrolidin-3-yl)phenyl]urea |
| SMILES | NC(=O)Nc1cccc(C2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C11H11N3O3/c12-11(17)14-7-3-1-2-6(4-7)9-8(15)5-13-10(9)16/h1-4,9H,5H2,(H,13,16)(H3,12,14,17) |
| InChIKey | JKFFVQQDNAHXCE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|