C15H20N2 — CID 57194101
1-(1H-indol-5-ylmethyl)-N,N-dimethylcyclobutan-1-amine (PubChem CID 57194101) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(1H-indol-5-ylmethyl)-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 1-(1H-indol-5-ylmethyl)-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 57194101 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-(1H-indol-5-ylmethyl)-N,N-dimethylcyclobutan-1-amine |
| SMILES | CN(C)C1(Cc2ccc3[nH]ccc3c2)CCC1 |
| InChI | InChI=1S/C15H20N2/c1-17(2)15(7-3-8-15)11-12-4-5-14-13(10-12)6-9-16-14/h4-6,9-10,16H,3,7-8,11H2,1-2H3 |
| InChIKey | UPJDRPFYYHRZBP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |