C25H32ClNO2 — CID 57195312
2-(4-chlorophenyl)-1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone (PubChem CID 57195312) has the molecular formula C25H32ClNO2 and a molecular weight of 413.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 57195312 |
| Molecular Formula | C25H32ClNO2 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[5-[4-(diethylaminomethyl)phenyl]-2-hydroxycyclohexyl]ethanone |
| SMILES | CCN(CC)Cc1ccc(C2CCC(O)C(C(=O)Cc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C25H32ClNO2/c1-3-27(4-2)17-19-5-9-20(10-6-19)21-11-14-24(28)23(16-21)25(29)15-18-7-12-22(26)13-8-18/h5-10,12-13,21,23-24,28H,3-4,11,14-17H2,1-2H3 |
| InChIKey | IUOMJCXKLBKGFL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |