C20H17N3O2 — CID 57196938
4-methyl-3-(nitrosomethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indole (PubChem CID 57196938) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-methyl-3-(nitrosomethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indole.
| Compound Name | 4-methyl-3-(nitrosomethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 57196938 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-methyl-3-(nitrosomethyl)-6-phenylmethoxy-9H-pyrido[3,4-b]indole |
| SMILES | Cc1c(CN=O)ncc2[nH]c3ccc(OCc4ccccc4)cc3c12 |
| InChI | InChI=1S/C20H17N3O2/c1-13-18(11-22-24)21-10-19-20(13)16-9-15(7-8-17(16)23-19)25-12-14-5-3-2-4-6-14/h2-10,23H,11-12H2,1H3 |
| InChIKey | BZORIFPPQPVJQI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |