C31H61N3O2 — CID 57197648
1-nonyl-3-[nonyl-(nonylamino)amino]pyrrole-2,5-diol (PubChem CID 57197648) has the molecular formula C31H61N3O2 and a molecular weight of 507.85 g/mol. Its IUPAC name is 1-nonyl-3-[nonyl-(nonylamino)amino]pyrrole-2,5-diol.
| Compound Name | 1-nonyl-3-[nonyl-(nonylamino)amino]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 57197648 |
| Molecular Formula | C31H61N3O2 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 507.48 |
| IUPAC Name | 1-nonyl-3-[nonyl-(nonylamino)amino]pyrrole-2,5-diol |
| SMILES | CCCCCCCCCNN(CCCCCCCCC)c1cc(O)n(CCCCCCCCC)c1O |
| InChI | InChI=1S/C31H61N3O2/c1-4-7-10-13-16-19-22-25-32-34(27-24-21-18-15-12-9-6-3)29-28-30(35)33(31(29)36)26-23-20-17-14-11-8-5-2/h28,32,35-36H,4-27H2,1-3H3 |
| InChIKey | SDZCTRKLJQHOHP-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|