C13H10Cl2O3S — CID 57198263
3-[3-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]propanoic acid (PubChem CID 57198263) has the molecular formula C13H10Cl2O3S and a molecular weight of 317.19 g/mol. Its IUPAC name is 3-[3-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]propanoic acid.
| Compound Name | 3-[3-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57198263 |
| Molecular Formula | C13H10Cl2O3S |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 3-[3-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1sccc1-c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2O3S/c14-9-5-7(6-10(15)13(9)18)8-3-4-19-11(8)1-2-12(16)17/h3-6,18H,1-2H2,(H,16,17) |
| InChIKey | BLEBAEVVDCNVJL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |